C23H24N8O — CID 110172291
1-[4-[2-amino-8-(4-aminophenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone (PubChem CID 110172291) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-[4-[2-amino-8-(4-aminophenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-[2-amino-8-(4-aminophenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 110172291 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[4-[2-amino-8-(4-aminophenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone |
| SMILES | Nc1ccc(-c2nc3nc(N)nc(N4CCN(C(=O)Cc5ccccc5)CC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C23H24N8O/c24-17-8-6-16(7-9-17)20-26-19-21(27-20)28-23(25)29-22(19)31-12-10-30(11-13-31)18(32)14-15-4-2-1-3-5-15/h1-9H,10-14,24H2,(H3,25,26,27,28,29) |
| InChIKey | IKABMCMKRXQIPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|