C23H23N7O2 — CID 110172289
1-[4-[2-amino-8-(3-hydroxyphenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone (PubChem CID 110172289) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-[4-[2-amino-8-(3-hydroxyphenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-[2-amino-8-(3-hydroxyphenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 110172289 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-[4-[2-amino-8-(3-hydroxyphenyl)-7H-purin-6-yl]piperazin-1-yl]-2-phenylethanone |
| SMILES | Nc1nc(N2CCN(C(=O)Cc3ccccc3)CC2)c2[nH]c(-c3cccc(O)c3)nc2n1 |
| InChI | InChI=1S/C23H23N7O2/c24-23-27-21-19(25-20(26-21)16-7-4-8-17(31)14-16)22(28-23)30-11-9-29(10-12-30)18(32)13-15-5-2-1-3-6-15/h1-8,14,31H,9-13H2,(H3,24,25,26,27,28) |
| InChIKey | JIOSQDXATRUEBD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |