C19H19NO3 — CID 56945192
2-[4-(dimethylamino)phenyl]-3-hydroxy-6,7-dimethylchromen-4-one (PubChem CID 56945192) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-3-hydroxy-6,7-dimethylchromen-4-one.
| Compound Name | 2-[4-(dimethylamino)phenyl]-3-hydroxy-6,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 56945192 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-3-hydroxy-6,7-dimethylchromen-4-one |
| SMILES | Cc1cc2oc(-c3ccc(N(C)C)cc3)c(O)c(=O)c2cc1C |
| InChI | InChI=1S/C19H19NO3/c1-11-9-15-16(10-12(11)2)23-19(18(22)17(15)21)13-5-7-14(8-6-13)20(3)4/h5-10,22H,1-4H3 |
| InChIKey | WRIWTYLNRACLEA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |