C28H29NO6 — CID 56946574
oxalic acid;5-[(2-phenoxyethylamino)methyl]-2,2-diphenylcyclopentan-1-one (PubChem CID 56946574) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is oxalic acid;5-[(2-phenoxyethylamino)methyl]-2,2-diphenylcyclopentan-1-one.
| Compound Name | oxalic acid;5-[(2-phenoxyethylamino)methyl]-2,2-diphenylcyclopentan-1-one |
|---|---|
| PubChem CID | 56946574 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | oxalic acid;5-[(2-phenoxyethylamino)methyl]-2,2-diphenylcyclopentan-1-one |
| SMILES | O=C(O)C(=O)O.O=C1C(CNCCOc2ccccc2)CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2.C2H2O4/c28-25-21(20-27-18-19-29-24-14-8-3-9-15-24)16-17-26(25,22-10-4-1-5-11-22)23-12-6-2-7-13-23;3-1(4)2(5)6/h1-15,21,27H,16-20H2;(H,3,4)(H,5,6) |
| InChIKey | CFZKQWGVQRAOPG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|