C32H63NO — CID 56948277
(2R)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]dodecan-2-amine (PubChem CID 56948277) has the molecular formula C32H63NO and a molecular weight of 477.86 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]dodecan-2-amine.
| Compound Name | (2R)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]dodecan-2-amine |
|---|---|
| PubChem CID | 56948277 |
| Molecular Formula | C32H63NO |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 477.49 |
| IUPAC Name | (2R)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]dodecan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@@H](CCCCCCCCCC)N(C)C |
| InChI | InChI=1S/C32H63NO/c1-5-7-9-11-13-15-16-17-18-19-20-21-22-24-26-28-30-34-31-32(33(3)4)29-27-25-23-14-12-10-8-6-2/h13,15,17-18,32H,5-12,14,16,19-31H2,1-4H3/b15-13-,18-17-/t32-/m1/s1 |
| InChIKey | LZTWRQMWIAPEMV-KSSUGRGDSA-N |
| XLogP | 10.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|