C8H5BrN2O2S — CID 56949904
(5Z)-5-[(5-bromothiophen-2-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 56949904) has the molecular formula C8H5BrN2O2S and a molecular weight of 273.11 g/mol. Its IUPAC name is (5Z)-5-[(5-bromothiophen-2-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(5-bromothiophen-2-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56949904 |
| Molecular Formula | C8H5BrN2O2S |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | (5Z)-5-[(5-bromothiophen-2-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(Br)s2)N1 |
| InChI | InChI=1S/C8H5BrN2O2S/c9-6-2-1-4(14-6)3-5-7(12)11-8(13)10-5/h1-3H,(H2,10,11,12,13)/b5-3- |
| InChIKey | MQCYENFKVABPNZ-HYXAFXHYSA-N |
| XLogP | 1.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|