C18H21N3O3 — CID 56951830
N-methyl-N-[3-(4-methylpiperazin-1-yl)-1,4-dioxonaphthalen-2-yl]acetamide (PubChem CID 56951830) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-methyl-N-[3-(4-methylpiperazin-1-yl)-1,4-dioxonaphthalen-2-yl]acetamide.
| Compound Name | N-methyl-N-[3-(4-methylpiperazin-1-yl)-1,4-dioxonaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 56951830 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-methyl-N-[3-(4-methylpiperazin-1-yl)-1,4-dioxonaphthalen-2-yl]acetamide |
| SMILES | CC(=O)N(C)C1=C(N2CCN(C)CC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H21N3O3/c1-12(22)20(3)15-16(21-10-8-19(2)9-11-21)18(24)14-7-5-4-6-13(14)17(15)23/h4-7H,8-11H2,1-3H3 |
| InChIKey | VIQVDFDJMHSPHO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|