C20H31N5O3 — CID 56953609
(2S)-2-[1-(2-amino-2-oxoethyl)-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]-N-butylpyrrolidine-1-carboxamide (PubChem CID 56953609) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2S)-2-[1-(2-amino-2-oxoethyl)-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]-N-butylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-[1-(2-amino-2-oxoethyl)-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]-N-butylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 56953609 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (2S)-2-[1-(2-amino-2-oxoethyl)-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]-N-butylpyrrolidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCC[C@H]1c1nn(CC(N)=O)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C20H31N5O3/c1-4-5-8-22-19(28)24-9-6-7-13(24)18-17-14(25(23-18)12-16(21)27)10-20(2,3)11-15(17)26/h13H,4-12H2,1-3H3,(H2,21,27)(H,22,28)/t13-/m0/s1 |
| InChIKey | IMRLXYQHVOPUFB-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|