C14H23N5O3 — CID 167899419
ethyl 5-[1-(butylcarbamoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate (PubChem CID 167899419) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 5-[1-(butylcarbamoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[1-(butylcarbamoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 167899419 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | ethyl 5-[1-(butylcarbamoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate |
| SMILES | CCCCNC(=O)N1CCCC1c1n[nH]nc1C(=O)OCC |
| InChI | InChI=1S/C14H23N5O3/c1-3-5-8-15-14(21)19-9-6-7-10(19)11-12(17-18-16-11)13(20)22-4-2/h10H,3-9H2,1-2H3,(H,15,21)(H,16,17,18) |
| InChIKey | UVEVYQHMAGVVQH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|