C14H22N4O4S — CID 167948593
ethyl 5-[1-(2-cyclopropylethylsulfonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate (PubChem CID 167948593) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl 5-[1-(2-cyclopropylethylsulfonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[1-(2-cyclopropylethylsulfonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 167948593 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | ethyl 5-[1-(2-cyclopropylethylsulfonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1C1CCCN1S(=O)(=O)CCC1CC1 |
| InChI | InChI=1S/C14H22N4O4S/c1-2-22-14(19)13-12(15-17-16-13)11-4-3-8-18(11)23(20,21)9-7-10-5-6-10/h10-11H,2-9H2,1H3,(H,15,16,17) |
| InChIKey | APBIQDKXONSVLC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |