C14H20N4O4 — CID 58958688
5-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid (PubChem CID 58958688) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 5-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid.
| Compound Name | 5-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58958688 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 5-[1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1c1n[nH]nc1C(=O)O |
| InChI | InChI=1S/C14H20N4O4/c1-4-14(2,3)11(19)12(20)18-7-5-6-8(18)9-10(13(21)22)16-17-15-9/h8H,4-7H2,1-3H3,(H,21,22)(H,15,16,17) |
| InChIKey | HMZIIGHYXWHQDF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|