C15H15ClN4O3S — CID 166275564
5-[1-(2-chloro-4-methylsulfanylbenzoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid (PubChem CID 166275564) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is 5-[1-(2-chloro-4-methylsulfanylbenzoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid.
| Compound Name | 5-[1-(2-chloro-4-methylsulfanylbenzoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166275564 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 5-[1-(2-chloro-4-methylsulfanylbenzoyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid |
| SMILES | CSc1ccc(C(=O)N2CCCC2c2n[nH]nc2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClN4O3S/c1-24-8-4-5-9(10(16)7-8)14(21)20-6-2-3-11(20)12-13(15(22)23)18-19-17-12/h4-5,7,11H,2-3,6H2,1H3,(H,22,23)(H,17,18,19) |
| InChIKey | QWNOMWNKEMFDGD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |