C15H22N4O3 — CID 166275565
5-[1-(3-propan-2-ylcyclobutanecarbonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid (PubChem CID 166275565) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-[1-(3-propan-2-ylcyclobutanecarbonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid.
| Compound Name | 5-[1-(3-propan-2-ylcyclobutanecarbonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166275565 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-[1-(3-propan-2-ylcyclobutanecarbonyl)pyrrolidin-2-yl]-2H-triazole-4-carboxylic acid |
| SMILES | CC(C)C1CC(C(=O)N2CCCC2c2n[nH]nc2C(=O)O)C1 |
| InChI | InChI=1S/C15H22N4O3/c1-8(2)9-6-10(7-9)14(20)19-5-3-4-11(19)12-13(15(21)22)17-18-16-12/h8-11H,3-7H2,1-2H3,(H,21,22)(H,16,17,18) |
| InChIKey | UDDBNJAUFKKHCO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |