C12H19N5O2S — CID 58958734
3,3-dimethyl-1-[2-(5-sulfanylidene-2H-tetrazol-1-yl)pyrrolidin-1-yl]pentane-1,2-dione (PubChem CID 58958734) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-(5-sulfanylidene-2H-tetrazol-1-yl)pyrrolidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[2-(5-sulfanylidene-2H-tetrazol-1-yl)pyrrolidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 58958734 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3,3-dimethyl-1-[2-(5-sulfanylidene-2H-tetrazol-1-yl)pyrrolidin-1-yl]pentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1n1[nH]nnc1=S |
| InChI | InChI=1S/C12H19N5O2S/c1-4-12(2,3)9(18)10(19)16-7-5-6-8(16)17-11(20)13-14-15-17/h8H,4-7H2,1-3H3,(H,13,15,20) |
| InChIKey | AKQPZEFEAFLVNB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|