C19H29O7P — CID 56956535
(3R,4S)-1-dimethoxyphosphoryl-4-(1,3-dioxolan-2-ylmethyl)-3-methyl-5-phenylmethoxypentan-2-one (PubChem CID 56956535) has the molecular formula C19H29O7P and a molecular weight of 400.41 g/mol. Its IUPAC name is (3R,4S)-1-dimethoxyphosphoryl-4-(1,3-dioxolan-2-ylmethyl)-3-methyl-5-phenylmethoxypentan-2-one.
| Compound Name | (3R,4S)-1-dimethoxyphosphoryl-4-(1,3-dioxolan-2-ylmethyl)-3-methyl-5-phenylmethoxypentan-2-one |
|---|---|
| PubChem CID | 56956535 |
| Molecular Formula | C19H29O7P |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (3R,4S)-1-dimethoxyphosphoryl-4-(1,3-dioxolan-2-ylmethyl)-3-methyl-5-phenylmethoxypentan-2-one |
| SMILES | COP(=O)(CC(=O)[C@H](C)[C@@H](COCc1ccccc1)CC1OCCO1)OC |
| InChI | InChI=1S/C19H29O7P/c1-15(18(20)14-27(21,22-2)23-3)17(11-19-25-9-10-26-19)13-24-12-16-7-5-4-6-8-16/h4-8,15,17,19H,9-14H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | AWEQJTCHRFFJLT-NVXWUHKLSA-N |
| XLogP | 3.27 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|