C26H22F12N2O2P2 — CID 56957123
4-[[4-[1-[(4-formylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dihexafluorophosphate (PubChem CID 56957123) has the molecular formula C26H22F12N2O2P2 and a molecular weight of 684.40 g/mol. Its IUPAC name is 4-[[4-[1-[(4-formylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dihexafluorophosphate.
| Compound Name | 4-[[4-[1-[(4-formylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dihexafluorophosphate |
|---|---|
| PubChem CID | 56957123 |
| Molecular Formula | C26H22F12N2O2P2 |
| Molecular Weight | 684.40 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | 4-[[4-[1-[(4-formylphenyl)methyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dihexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.O=Cc1ccc(C[n+]2ccc(-c3cc[n+](Cc4ccc(C=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O2.2F6P/c29-19-23-5-1-21(2-6-23)17-27-13-9-25(10-14-27)26-11-15-28(16-12-26)18-22-3-7-24(20-30)8-4-22;2*1-7(2,3,4,5)6/h1-16,19-20H,17-18H2;;/q+2;2*-1 |
| InChIKey | QOGYSGWAPVCWCH-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.40 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|