C24H29Br2N2O4P — CID 56957459
4-[[4-[1-(2-diethoxyphosphorylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dibromide (PubChem CID 56957459) has the molecular formula C24H29Br2N2O4P and a molecular weight of 600.29 g/mol. Its IUPAC name is 4-[[4-[1-(2-diethoxyphosphorylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dibromide.
| Compound Name | 4-[[4-[1-(2-diethoxyphosphorylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dibromide |
|---|---|
| PubChem CID | 56957459 |
| Molecular Formula | C24H29Br2N2O4P |
| Molecular Weight | 600.29 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | 4-[[4-[1-(2-diethoxyphosphorylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]methyl]benzaldehyde dibromide |
| SMILES | CCOP(=O)(CC[n+]1ccc(-c2cc[n+](Cc3ccc(C=O)cc3)cc2)cc1)OCC.[Br-].[Br-] |
| InChI | InChI=1S/C24H29N2O4P.2BrH/c1-3-29-31(28,30-4-2)18-17-25-13-9-23(10-14-25)24-11-15-26(16-12-24)19-21-5-7-22(20-27)8-6-21;;/h5-16,20H,3-4,17-19H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | VGFOJXPEEVTSIW-UHFFFAOYSA-L |
| XLogP | -1.94 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.29 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|