About 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane
4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane (PubChem CID 91380807) has the molecular formula C24H25O4P
and a molecular weight of 408.43 g/mol. Its IUPAC name is 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane.
Molecular Properties
| Compound Name | 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane |
| PubChem CID | 91380807 |
| Molecular Formula | C24H25O4P |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane |
| SMILES | C=O.CCOP=O.CCc1ccc(-c2ccc(-c3ccc(C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H18O.C2H5O2P.CH2O/c1-2-16-3-7-18(8-4-16)20-11-13-21(14-12-20)19-9-5-17(15-22)6-10-19;1-2-4-5-3;1-2/h3-15H,2H2,1H3;2H2,1H3;1H2 |
| InChIKey | SSFSHJIEUKIKEH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane?
The IUPAC name of 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane (CID 91380807) is 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane.
What is the SMILES notation for 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane?
The canonical SMILES for 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane is C=O.CCOP=O.CCc1ccc(-c2ccc(-c3ccc(C=O)cc3)cc2)cc1.
What is the InChIKey of 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane?
The InChIKey is SSFSHJIEUKIKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O.C2H5O2P.CH2O/c1-2-16-3-7-18(8-4-16)20-11-13-21(14-12-20)19-9-5-17(15-22)6-10-19;1-2-4-5-3;1-2/h3-15H,2H2,1H3;2H2,1H3;1H2.
What are the key properties of 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane?
4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane has a molecular weight of 408.43 g/mol, XLogP of 6.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-ethylphenyl)phenyl]benzaldehyde;formaldehyde;1-phosphorosooxyethane is sourced from PubChem (CID 91380807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).