C21H24O — CID 56957260
[(E)-3-[(Z)-6-phenylhex-3-enoxy]prop-1-enyl]benzene (PubChem CID 56957260) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is [(E)-3-[(Z)-6-phenylhex-3-enoxy]prop-1-enyl]benzene.
| Compound Name | [(E)-3-[(Z)-6-phenylhex-3-enoxy]prop-1-enyl]benzene |
|---|---|
| PubChem CID | 56957260 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [(E)-3-[(Z)-6-phenylhex-3-enoxy]prop-1-enyl]benzene |
| SMILES | C(=C\CCc1ccccc1)\CCOC/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H24O/c1(5-12-20-13-6-3-7-14-20)2-10-18-22-19-11-17-21-15-8-4-9-16-21/h1-4,6-9,11,13-17H,5,10,12,18-19H2/b2-1-,17-11+ |
| InChIKey | BKAQWMWKAKJSBA-UHVQITDKSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|