C28H54O7Si — CID 56957603
(3R,5S,6S)-3-[(E,1R,4R,8S)-1-hydroxy-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 56957603) has the molecular formula C28H54O7Si and a molecular weight of 530.82 g/mol. Its IUPAC name is (3R,5S,6S)-3-[(E,1R,4R,8S)-1-hydroxy-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3R,5S,6S)-3-[(E,1R,4R,8S)-1-hydroxy-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 56957603 |
| Molecular Formula | C28H54O7Si |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (3R,5S,6S)-3-[(E,1R,4R,8S)-1-hydroxy-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | CO[C@@]1(C)OC(=O)[C@@H]([C@H](O)/C=C/[C@H](C)CCC[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)O[C@]1(C)OC |
| InChI | InChI=1S/C28H54O7Si/c1-19(2)36(20(3)4,21(5)6)33-18-23(8)15-13-14-22(7)16-17-24(29)25-26(30)35-28(10,32-12)27(9,31-11)34-25/h16-17,19-25,29H,13-15,18H2,1-12H3/b17-16+/t22-,23+,24-,25-,27+,28+/m1/s1 |
| InChIKey | FTDCSWSOFPOUBV-HZKZVSNISA-N |
| XLogP | 6.21 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|