C20H38O7Si — CID 177396999
methyl (2S,3R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-6-methylhept-4-enoate (PubChem CID 177396999) has the molecular formula C20H38O7Si and a molecular weight of 418.60 g/mol. Its IUPAC name is methyl (2S,3R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-6-methylhept-4-enoate.
| Compound Name | methyl (2S,3R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-6-methylhept-4-enoate |
|---|---|
| PubChem CID | 177396999 |
| Molecular Formula | C20H38O7Si |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | methyl (2S,3R,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxy-6-methylhept-4-enoate |
| SMILES | COC(=O)[C@@H](O)[C@H](O)C=C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H38O7Si/c1-13(10-11-14(21)16(22)18(23)24-7)17(15-12-25-20(5,6)26-15)27-28(8,9)19(2,3)4/h10-11,13-17,21-22H,12H2,1-9H3/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | AWZKOTRVEVXHBW-OVYGPGRDSA-N |
| XLogP | 2.62 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|