C18H36O6Si — CID 10619569
(E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoic acid (PubChem CID 10619569) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoic acid.
| Compound Name | (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoic acid |
|---|---|
| PubChem CID | 10619569 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoic acid |
| SMILES | COCCOCOC(C)(C)C/C=C/[C@@H](O)[C@@H](C(=O)O)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C18H36O6Si/c1-14(25(5,6)7)16(17(20)21)15(19)9-8-10-18(2,3)24-13-23-12-11-22-4/h8-9,14-16,19H,10-13H2,1-7H3,(H,20,21)/b9-8+/t14-,15-,16+/m1/s1 |
| InChIKey | PPTRGUCHGHNXGX-RLAHGTIISA-N |
| XLogP | 3.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|