C36H64O7Si3 — CID 10974478
methyl (1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-triethylsilyl-3-triethylsilyloxyhexa-1,5-diynyl]-2-hydroxycyclopent-3-ene-1-carboxylate (PubChem CID 10974478) has the molecular formula C36H64O7Si3 and a molecular weight of 693.16 g/mol. Its IUPAC name is methyl (1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-triethylsilyl-3-triethylsilyloxyhexa-1,5-diynyl]-2-hydroxycyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-triethylsilyl-3-triethylsilyloxyhexa-1,5-diynyl]-2-hydroxycyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10974478 |
| Molecular Formula | C36H64O7Si3 |
| Molecular Weight | 693.16 g/mol |
| Exact Mass | 692.40 |
| IUPAC Name | methyl (1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-triethylsilyl-3-triethylsilyloxyhexa-1,5-diynyl]-2-hydroxycyclopent-3-ene-1-carboxylate |
| SMILES | CC[Si](C#CC[C@](C#C[C@]1(O)C=CC[C@]1(O[Si](C)(C)C(C)(C)C)C(=O)OC)(O[Si](CC)(CC)CC)[C@H]1COC(C)(C)O1)(CC)CC |
| InChI | InChI=1S/C36H64O7Si3/c1-15-45(16-2,17-3)28-22-23-34(30-29-40-33(10,11)41-30,42-46(18-4,19-5)20-6)26-27-35(38)24-21-25-36(35,31(37)39-12)43-44(13,14)32(7,8)9/h21,24,30,38H,15-20,23,25,29H2,1-14H3/t30-,34-,35-,36+/m1/s1 |
| InChIKey | PRKSETYVZBUYQF-MGCMMHMJSA-N |
| XLogP | 7.97 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.16 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|