C22H46O6Si2 — CID 132603549
ethyl (E,2S,3R,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3-dihydroxyoct-4-enoate (PubChem CID 132603549) has the molecular formula C22H46O6Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is ethyl (E,2S,3R,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3-dihydroxyoct-4-enoate.
| Compound Name | ethyl (E,2S,3R,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3-dihydroxyoct-4-enoate |
|---|---|
| PubChem CID | 132603549 |
| Molecular Formula | C22H46O6Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | ethyl (E,2S,3R,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3-dihydroxyoct-4-enoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O6Si2/c1-13-26-20(25)19(24)17(23)14-15-18(28-30(11,12)22(6,7)8)16(2)27-29(9,10)21(3,4)5/h14-19,23-24H,13H2,1-12H3/b15-14+/t16-,17+,18-,19-/m0/s1 |
| InChIKey | GDAGGFWWQHTRSJ-ISWCZIFLSA-N |
| XLogP | 4.63 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|