C22H44O6Si2 — CID 10389555
[(2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3,6,7-tetrahydrooxepin-3-yl] acetate (PubChem CID 10389555) has the molecular formula C22H44O6Si2 and a molecular weight of 460.76 g/mol. Its IUPAC name is [(2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3,6,7-tetrahydrooxepin-3-yl] acetate.
| Compound Name | [(2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3,6,7-tetrahydrooxepin-3-yl] acetate |
|---|---|
| PubChem CID | 10389555 |
| Molecular Formula | C22H44O6Si2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | [(2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-2,3,6,7-tetrahydrooxepin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O6Si2/c1-16(23)27-18-13-12-17(24)19(14-25-29(8,9)21(2,3)4)28-20(18)15-26-30(10,11)22(5,6)7/h12-13,17-20,24H,14-15H2,1-11H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | YBXJDQIYWSFHFF-NMLBUPMWSA-N |
| XLogP | 4.65 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|