C20H42O5Si2 — CID 11015279
(2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol (PubChem CID 11015279) has the molecular formula C20H42O5Si2 and a molecular weight of 418.72 g/mol. Its IUPAC name is (2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol.
| Compound Name | (2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol |
|---|---|
| PubChem CID | 11015279 |
| Molecular Formula | C20H42O5Si2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2S,3R,6S,7R)-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)C=C[C@H]1O |
| InChI | InChI=1S/C20H42O5Si2/c1-19(2,3)26(7,8)23-13-17-15(21)11-12-16(22)18(25-17)14-24-27(9,10)20(4,5)6/h11-12,15-18,21-22H,13-14H2,1-10H3/t15-,16+,17+,18- |
| InChIKey | NZECSWDVFXGRJU-FZDBZEDMSA-N |
| XLogP | 4.08 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|