C26H54O5Si2 — CID 100966710
(2S,3R,6S,7R)-2,7-bis[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol (PubChem CID 100966710) has the molecular formula C26H54O5Si2 and a molecular weight of 502.89 g/mol. Its IUPAC name is (2S,3R,6S,7R)-2,7-bis[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol.
| Compound Name | (2S,3R,6S,7R)-2,7-bis[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol |
|---|---|
| PubChem CID | 100966710 |
| Molecular Formula | C26H54O5Si2 |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | (2S,3R,6S,7R)-2,7-bis[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepine-3,6-diol |
| SMILES | CC(C)[Si](OC[C@@H]1O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)C=C[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H54O5Si2/c1-17(2)32(18(3)4,19(5)6)29-15-25-23(27)13-14-24(28)26(31-25)16-30-33(20(7)8,21(9)10)22(11)12/h13-14,17-28H,15-16H2,1-12H3/t23-,24+,25+,26- |
| InChIKey | JTVSIUHUSWPAGC-FATVKVNYSA-N |
| XLogP | 6.42 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|