C9H13IO4 — CID 56957630
2-[(2S,3S)-2-(iodomethyl)-5-oxooxolan-3-yl]ethyl acetate (PubChem CID 56957630) has the molecular formula C9H13IO4 and a molecular weight of 312.10 g/mol. Its IUPAC name is 2-[(2S,3S)-2-(iodomethyl)-5-oxooxolan-3-yl]ethyl acetate.
| Compound Name | 2-[(2S,3S)-2-(iodomethyl)-5-oxooxolan-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 56957630 |
| Molecular Formula | C9H13IO4 |
| Molecular Weight | 312.10 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[(2S,3S)-2-(iodomethyl)-5-oxooxolan-3-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1CC(=O)O[C@@H]1CI |
| InChI | InChI=1S/C9H13IO4/c1-6(11)13-3-2-7-4-9(12)14-8(7)5-10/h7-8H,2-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | PXIXMHGGPWCULE-JGVFFNPUSA-N |
| XLogP | 1.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.10 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|