C10H14O6 — CID 20816435
[3-(1,3-dioxolan-2-yl)-5-oxooxolan-2-yl]methyl acetate (PubChem CID 20816435) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is [3-(1,3-dioxolan-2-yl)-5-oxooxolan-2-yl]methyl acetate.
| Compound Name | [3-(1,3-dioxolan-2-yl)-5-oxooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 20816435 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [3-(1,3-dioxolan-2-yl)-5-oxooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(=O)CC1C1OCCO1 |
| InChI | InChI=1S/C10H14O6/c1-6(11)15-5-8-7(4-9(12)16-8)10-13-2-3-14-10/h7-8,10H,2-5H2,1H3 |
| InChIKey | MNMDDMBKRIGVEF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |