C22H36O13 — CID 10097769
[(1R,18S,20R,21S,22R)-21,22-diacetyloxy-2,5,8,11,14,17,19-heptaoxabicyclo[16.2.2]docosan-20-yl]methyl acetate (PubChem CID 10097769) has the molecular formula C22H36O13 and a molecular weight of 508.52 g/mol. Its IUPAC name is [(1R,18S,20R,21S,22R)-21,22-diacetyloxy-2,5,8,11,14,17,19-heptaoxabicyclo[16.2.2]docosan-20-yl]methyl acetate.
| Compound Name | [(1R,18S,20R,21S,22R)-21,22-diacetyloxy-2,5,8,11,14,17,19-heptaoxabicyclo[16.2.2]docosan-20-yl]methyl acetate |
|---|---|
| PubChem CID | 10097769 |
| Molecular Formula | C22H36O13 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [(1R,18S,20R,21S,22R)-21,22-diacetyloxy-2,5,8,11,14,17,19-heptaoxabicyclo[16.2.2]docosan-20-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OCCOCCOCCOCCOCCO[C@H]1[C@H](OC(C)=O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C22H36O13/c1-15(23)32-14-18-19-20(33-16(2)24)21(34-17(3)25)22(35-18)31-13-11-29-9-7-27-5-4-26-6-8-28-10-12-30-19/h18-22H,4-14H2,1-3H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | SBIWNOKWZOIXOR-BDHVOXNPSA-N |
| XLogP | -0.38 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|