C17H16F5N5O4 — CID 56959284
2-(2-hydroxy-1,3-dimethyl-6-oxo-2H-purin-7-yl)-N-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]acetamide (PubChem CID 56959284) has the molecular formula C17H16F5N5O4 and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-(2-hydroxy-1,3-dimethyl-6-oxo-2H-purin-7-yl)-N-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]acetamide.
| Compound Name | 2-(2-hydroxy-1,3-dimethyl-6-oxo-2H-purin-7-yl)-N-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 56959284 |
| Molecular Formula | C17H16F5N5O4 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-(2-hydroxy-1,3-dimethyl-6-oxo-2H-purin-7-yl)-N-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]acetamide |
| SMILES | CN1C(=O)c2c(ncn2CC(=O)Nc2ccc(OC(F)(F)C(F)(F)F)cc2)N(C)C1O |
| InChI | InChI=1S/C17H16F5N5O4/c1-25-13-12(14(29)26(2)15(25)30)27(8-23-13)7-11(28)24-9-3-5-10(6-4-9)31-17(21,22)16(18,19)20/h3-6,8,15,30H,7H2,1-2H3,(H,24,28) |
| InChIKey | BBAMETQILBPWSS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|