C28H26N4O6S — CID 56960791
benzyl 4-[6-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 56960791) has the molecular formula C28H26N4O6S and a molecular weight of 546.61 g/mol. Its IUPAC name is benzyl 4-[6-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-[6-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 56960791 |
| Molecular Formula | C28H26N4O6S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | benzyl 4-[6-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | Cc1c(Oc2ccc(/C=C3\SC(=O)NC3=O)cc2)ncnc1OC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H26N4O6S/c1-18-25(37-21-9-7-19(8-10-21)15-23-24(33)31-27(34)39-23)29-17-30-26(18)38-22-11-13-32(14-12-22)28(35)36-16-20-5-3-2-4-6-20/h2-10,15,17,22H,11-14,16H2,1H3,(H,31,33,34)/b23-15- |
| InChIKey | YCNMLKZXXUGWHI-HAHDFKILSA-N |
| XLogP | 5.08 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|