C19H27N3O — CID 56960901
2-[[2-(4-cyclopropylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 56960901) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-[[2-(4-cyclopropylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[[2-(4-cyclopropylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 56960901 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 2-[[2-(4-cyclopropylphenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CNC2CC2c2ccc(C3CC3)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-21-8-10-22(11-9-21)19(23)13-20-18-12-17(18)16-6-4-15(5-7-16)14-2-3-14/h4-7,14,17-18,20H,2-3,8-13H2,1H3 |
| InChIKey | KEJFJWNFPOBVPT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |