C21H26N4O — CID 67368844
1-(4-methylpiperazin-1-yl)-2-[[2-(4-pyridin-3-ylphenyl)cyclopropyl]amino]ethanone (PubChem CID 67368844) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-[[2-(4-pyridin-3-ylphenyl)cyclopropyl]amino]ethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-[[2-(4-pyridin-3-ylphenyl)cyclopropyl]amino]ethanone |
|---|---|
| PubChem CID | 67368844 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-[[2-(4-pyridin-3-ylphenyl)cyclopropyl]amino]ethanone |
| SMILES | CN1CCN(C(=O)CNC2CC2c2ccc(-c3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C21H26N4O/c1-24-9-11-25(12-10-24)21(26)15-23-20-13-19(20)17-6-4-16(5-7-17)18-3-2-8-22-14-18/h2-8,14,19-20,23H,9-13,15H2,1H3 |
| InChIKey | AJPZFGUJBLWPFR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |