C12H13NO2 — CID 569617
4,4-dimethyl-2-phenyl-5H-1,3-oxazin-6-one (PubChem CID 569617) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4,4-dimethyl-2-phenyl-5H-1,3-oxazin-6-one.
| Compound Name | 4,4-dimethyl-2-phenyl-5H-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 569617 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4,4-dimethyl-2-phenyl-5H-1,3-oxazin-6-one |
| SMILES | CC1(C)CC(=O)OC(c2ccccc2)=N1 |
| InChI | InChI=1S/C12H13NO2/c1-12(2)8-10(14)15-11(13-12)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | JNMOTQUPKBWBSF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |