C25H28N8O3 — CID 56962586
5-[(3,4-dimethoxyphenyl)methyl]-1-[2-methyl-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethoxy)pyrimidin-4-yl]-1,2,4-triazol-3-amine (PubChem CID 56962586) has the molecular formula C25H28N8O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methyl]-1-[2-methyl-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethoxy)pyrimidin-4-yl]-1,2,4-triazol-3-amine.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methyl]-1-[2-methyl-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethoxy)pyrimidin-4-yl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 56962586 |
| Molecular Formula | C25H28N8O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methyl]-1-[2-methyl-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethoxy)pyrimidin-4-yl]-1,2,4-triazol-3-amine |
| SMILES | COc1ccc(Cc2nc(N)nn2-c2cc(OCc3ccc4c(n3)NCCC4)nc(C)n2)cc1OC |
| InChI | InChI=1S/C25H28N8O3/c1-15-28-22(13-23(29-15)36-14-18-8-7-17-5-4-10-27-24(17)30-18)33-21(31-25(26)32-33)12-16-6-9-19(34-2)20(11-16)35-3/h6-9,11,13H,4-5,10,12,14H2,1-3H3,(H2,26,32)(H,27,30) |
| InChIKey | CETJXUXSUWFGET-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |