C20H29NO4 — CID 56965165
[(E,2R)-7-phenylhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 56965165) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(E,2R)-7-phenylhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(E,2R)-7-phenylhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 56965165 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [(E,2R)-7-phenylhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C[C@H](/C=C/CCCc1ccccc1)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO4/c1-16(11-7-5-8-12-17-13-9-6-10-14-17)24-18(22)15-21-19(23)25-20(2,3)4/h6-7,9-11,13-14,16H,5,8,12,15H2,1-4H3,(H,21,23)/b11-7+/t16-/m1/s1 |
| InChIKey | VSJVXXVQAJLUBY-AYAUWGRQSA-N |
| XLogP | 4.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|