About 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid
2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid (PubChem CID 56965726) has the molecular formula C5H2BrN3O2S
and a molecular weight of 248.06 g/mol. Its IUPAC name is 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid.
Analyze 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid?
The IUPAC name of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid (CID 56965726) is 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid.
What is the SMILES notation for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid?
The canonical SMILES for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid is O=C(O)c1cn2nc(Br)sc2n1.
What is the InChIKey of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid?
The InChIKey is WIJRPAZEAZYPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BrN3O2S/c6-4-8-9-1-2(3(10)11)7-5(9)12-4/h1H,(H,10,11).
What are the key properties of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid?
2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid has a molecular weight of 248.06 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid is sourced from PubChem (CID 56965726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).