C18H22N2O6S2 — CID 56968148
2-[1,1-dioxo-5-[(3-phenoxyphenyl)methyl]-1,2,5-thiadiazolidin-2-yl]ethyl methanesulfonate (PubChem CID 56968148) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[1,1-dioxo-5-[(3-phenoxyphenyl)methyl]-1,2,5-thiadiazolidin-2-yl]ethyl methanesulfonate.
| Compound Name | 2-[1,1-dioxo-5-[(3-phenoxyphenyl)methyl]-1,2,5-thiadiazolidin-2-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 56968148 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-[1,1-dioxo-5-[(3-phenoxyphenyl)methyl]-1,2,5-thiadiazolidin-2-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN1CCN(Cc2cccc(Oc3ccccc3)c2)S1(=O)=O |
| InChI | InChI=1S/C18H22N2O6S2/c1-27(21,22)25-13-12-19-10-11-20(28(19,23)24)15-16-6-5-9-18(14-16)26-17-7-3-2-4-8-17/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | BHYHZHMTHDWEGO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|