C16H21ClN2O3S — CID 56969032
(5Z)-3-(2-aminoethyl)-5-[3-(2-ethoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 56969032) has the molecular formula C16H21ClN2O3S and a molecular weight of 356.88 g/mol. Its IUPAC name is (5Z)-3-(2-aminoethyl)-5-[3-(2-ethoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | (5Z)-3-(2-aminoethyl)-5-[3-(2-ethoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 56969032 |
| Molecular Formula | C16H21ClN2O3S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (5Z)-3-(2-aminoethyl)-5-[3-(2-ethoxyphenyl)propylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CCOc1ccccc1CC/C=C1\SC(=O)N(CCN)C1=O.Cl |
| InChI | InChI=1S/C16H20N2O3S.ClH/c1-2-21-13-8-4-3-6-12(13)7-5-9-14-15(19)18(11-10-17)16(20)22-14;/h3-4,6,8-9H,2,5,7,10-11,17H2,1H3;1H/b14-9-; |
| InChIKey | WBWSORXQNUNVBV-WQRRWHLMSA-N |
| XLogP | 2.98 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|