C25H23Cl2N5O2 — CID 56969599
2-(2,6-dichloroanilino)-N-(2,6-dimethyl-3-pyridinyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 56969599) has the molecular formula C25H23Cl2N5O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-N-(2,6-dimethyl-3-pyridinyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-N-(2,6-dimethyl-3-pyridinyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56969599 |
| Molecular Formula | C25H23Cl2N5O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-(2,6-dichloroanilino)-N-(2,6-dimethyl-3-pyridinyl)-7,7-dimethyl-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3[nH]c(Nc4c(Cl)cccc4Cl)nc3c3c2OC(C)(C)C3)c(C)n1 |
| InChI | InChI=1S/C25H23Cl2N5O2/c1-12-8-9-18(13(2)28-12)29-23(33)14-10-19-20(15-11-25(3,4)34-22(14)15)31-24(30-19)32-21-16(26)6-5-7-17(21)27/h5-10H,11H2,1-4H3,(H,29,33)(H2,30,31,32) |
| InChIKey | GSGARPMOHVPMQB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |