C25H20ClF3N4O2 — CID 67503482
2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-(2,4,5-trifluorophenyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67503482) has the molecular formula C25H20ClF3N4O2 and a molecular weight of 500.91 g/mol. Its IUPAC name is 2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-(2,4,5-trifluorophenyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-(2,4,5-trifluorophenyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67503482 |
| Molecular Formula | C25H20ClF3N4O2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 2-(2-chloro-6-methylanilino)-7,7-dimethyl-N-(2,4,5-trifluorophenyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | Cc1cccc(Cl)c1Nc1nc2c3c(c(C(=O)Nc4cc(F)c(F)cc4F)cc2[nH]1)OC(C)(C)C3 |
| InChI | InChI=1S/C25H20ClF3N4O2/c1-11-5-4-6-14(26)20(11)32-24-31-19-7-12(22-13(21(19)33-24)10-25(2,3)35-22)23(34)30-18-9-16(28)15(27)8-17(18)29/h4-9H,10H2,1-3H3,(H,30,34)(H2,31,32,33) |
| InChIKey | UIGXSKKHTQYVMH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|