C14H8FNO4 — CID 56970493
N-(3-fluorophenyl)-2-oxo-1,3-benzodioxole-4-carboxamide (PubChem CID 56970493) has the molecular formula C14H8FNO4 and a molecular weight of 273.22 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-oxo-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-oxo-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 56970493 |
| Molecular Formula | C14H8FNO4 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-(3-fluorophenyl)-2-oxo-1,3-benzodioxole-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cccc2oc(=O)oc12 |
| InChI | InChI=1S/C14H8FNO4/c15-8-3-1-4-9(7-8)16-13(17)10-5-2-6-11-12(10)20-14(18)19-11/h1-7H,(H,16,17) |
| InChIKey | KUYSMLGLKGLCOX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |