C16H16N3O8P — CID 56971308
[(2R,3S,5R)-5-[6-(3-cyanophenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 56971308) has the molecular formula C16H16N3O8P and a molecular weight of 409.29 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[6-(3-cyanophenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-[6-(3-cyanophenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 56971308 |
| Molecular Formula | C16H16N3O8P |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [(2R,3S,5R)-5-[6-(3-cyanophenyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | N#Cc1cccc(-c2cc(=O)[nH]c(=O)n2[C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c1 |
| InChI | InChI=1S/C16H16N3O8P/c17-7-9-2-1-3-10(4-9)11-5-14(21)18-16(22)19(11)15-6-12(20)13(27-15)8-26-28(23,24)25/h1-5,12-13,15,20H,6,8H2,(H,18,21,22)(H2,23,24,25)/t12-,13+,15+/m0/s1 |
| InChIKey | CVGQEEVOUQYBHC-GZBFAFLISA-N |
| XLogP | -0.17 |
| TPSA | 174.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|