C25H20N3O9P — CID 101210963
[(2R,3S,5R)-5-[5-[2-[3-(4-cyanobenzoyl)phenyl]ethynyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 101210963) has the molecular formula C25H20N3O9P and a molecular weight of 537.42 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-[2-[3-(4-cyanobenzoyl)phenyl]ethynyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-[5-[2-[3-(4-cyanobenzoyl)phenyl]ethynyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101210963 |
| Molecular Formula | C25H20N3O9P |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | [(2R,3S,5R)-5-[5-[2-[3-(4-cyanobenzoyl)phenyl]ethynyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | N#Cc1ccc(C(=O)c2cccc(C#Cc3cn([C@H]4C[C@H](O)[C@@H](COP(=O)(O)O)O4)c(=O)[nH]c3=O)c2)cc1 |
| InChI | InChI=1S/C25H20N3O9P/c26-12-16-5-7-17(8-6-16)23(30)18-3-1-2-15(10-18)4-9-19-13-28(25(32)27-24(19)31)22-11-20(29)21(37-22)14-36-38(33,34)35/h1-3,5-8,10,13,20-22,29H,11,14H2,(H,27,31,32)(H2,33,34,35)/t20-,21+,22+/m0/s1 |
| InChIKey | OCJXFLMBNYZLTG-BHDDXSALSA-N |
| XLogP | 0.80 |
| TPSA | 191.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|