C23H30ClNO2S — CID 56971386
8-(2-chlorophenyl)-8-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,2-dimethyloctanoic acid (PubChem CID 56971386) has the molecular formula C23H30ClNO2S and a molecular weight of 420.02 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-8-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,2-dimethyloctanoic acid.
| Compound Name | 8-(2-chlorophenyl)-8-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 56971386 |
| Molecular Formula | C23H30ClNO2S |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 8-(2-chlorophenyl)-8-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,2-dimethyloctanoic acid |
| SMILES | CC(C)(CCCCCC(c1ccccc1Cl)N1CCc2sccc2C1)C(=O)O |
| InChI | InChI=1S/C23H30ClNO2S/c1-23(2,22(26)27)13-7-3-4-10-20(18-8-5-6-9-19(18)24)25-14-11-21-17(16-25)12-15-28-21/h5-6,8-9,12,15,20H,3-4,7,10-11,13-14,16H2,1-2H3,(H,26,27) |
| InChIKey | HPHVLGXUNOPBQC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|