C23H24Cl2N4O2 — CID 56971575
2-(2,6-dichloroanilino)-N-hexyl-7-methyl-3H-furo[3,2-e]benzimidazole-5-carboxamide (PubChem CID 56971575) has the molecular formula C23H24Cl2N4O2 and a molecular weight of 459.38 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-N-hexyl-7-methyl-3H-furo[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-N-hexyl-7-methyl-3H-furo[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56971575 |
| Molecular Formula | C23H24Cl2N4O2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-(2,6-dichloroanilino)-N-hexyl-7-methyl-3H-furo[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CCCCCCNC(=O)c1cc2[nH]c(Nc3c(Cl)cccc3Cl)nc2c2cc(C)oc12 |
| InChI | InChI=1S/C23H24Cl2N4O2/c1-3-4-5-6-10-26-22(30)15-12-18-19(14-11-13(2)31-21(14)15)28-23(27-18)29-20-16(24)8-7-9-17(20)25/h7-9,11-12H,3-6,10H2,1-2H3,(H,26,30)(H2,27,28,29) |
| InChIKey | ZKYMDHMGBUMRDE-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|