C24H24N4 — CID 56973477
7-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylimidazo[1,2-a]pyridine (PubChem CID 56973477) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 7-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylimidazo[1,2-a]pyridine.
| Compound Name | 7-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 56973477 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 7-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylimidazo[1,2-a]pyridine |
| SMILES | CN1CCN(c2ccc(-c3ccn4c(-c5ccccc5)cnc4c3)cc2)CC1 |
| InChI | InChI=1S/C24H24N4/c1-26-13-15-27(16-14-26)22-9-7-19(8-10-22)21-11-12-28-23(18-25-24(28)17-21)20-5-3-2-4-6-20/h2-12,17-18H,13-16H2,1H3 |
| InChIKey | UGNSVLICDPENOI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |