C27H29N5O2 — CID 126601592
N-hydroxy-2-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-3-phenylpropanamide (PubChem CID 126601592) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-hydroxy-2-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-3-phenylpropanamide.
| Compound Name | N-hydroxy-2-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126601592 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-hydroxy-2-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-3-phenylpropanamide |
| SMILES | CN1CCN(c2ccc(-c3ccn4c(C(Cc5ccccc5)C(=O)NO)cnc4c3)cc2)CC1 |
| InChI | InChI=1S/C27H29N5O2/c1-30-13-15-31(16-14-30)23-9-7-21(8-10-23)22-11-12-32-25(19-28-26(32)18-22)24(27(33)29-34)17-20-5-3-2-4-6-20/h2-12,18-19,24,34H,13-17H2,1H3,(H,29,33) |
| InChIKey | WCHZLGALFQRMOF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|