C8H3F5O3 — CID 56973642
3,5-difluoro-4-(trifluoromethoxy)benzoic acid (PubChem CID 56973642) has the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. Its IUPAC name is 3,5-difluoro-4-(trifluoromethoxy)benzoic acid.
| Compound Name | 3,5-difluoro-4-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 56973642 |
| Molecular Formula | C8H3F5O3 |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 3,5-difluoro-4-(trifluoromethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C8H3F5O3/c9-4-1-3(7(14)15)2-5(10)6(4)16-8(11,12)13/h1-2H,(H,14,15) |
| InChIKey | HFEYMZZPTKZDNA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |